C17H16FNO5S2 — CID 42362889
4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-fluorophenyl)benzamide (PubChem CID 42362889) has the molecular formula C17H16FNO5S2 and a molecular weight of 397.45 g/mol. Its IUPAC name is 4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-fluorophenyl)benzamide.
| Compound Name | 4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 42362889 |
| Molecular Formula | C17H16FNO5S2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 4-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccccc1F)c1ccc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H16FNO5S2/c18-15-3-1-2-4-16(15)19-17(20)12-5-7-13(8-6-12)26(23,24)14-9-10-25(21,22)11-14/h1-8,14H,9-11H2,(H,19,20)/t14-/m1/s1 |
| InChIKey | XGDZTBOFIBGLIF-CQSZACIVSA-N |
| XLogP | 2.04 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |