C19H20FNO5S2 — CID 42364271
5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-phenylethyl)benzamide (PubChem CID 42364271) has the molecular formula C19H20FNO5S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42364271 |
| Molecular Formula | C19H20FNO5S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 5-[(3S)-1,1-dioxothiolan-3-yl]sulfonyl-2-fluoro-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1cc(S(=O)(=O)[C@H]2CCS(=O)(=O)C2)ccc1F |
| InChI | InChI=1S/C19H20FNO5S2/c20-18-7-6-15(28(25,26)16-9-11-27(23,24)13-16)12-17(18)19(22)21-10-8-14-4-2-1-3-5-14/h1-7,12,16H,8-11,13H2,(H,21,22)/t16-/m0/s1 |
| InChIKey | CTHAPAYJCZOFNI-INIZCTEOSA-N |
| XLogP | 1.76 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |