C18H16N2O5S2 — CID 42363140
N-(3-cyanophenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzamide (PubChem CID 42363140) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzamide.
| Compound Name | N-(3-cyanophenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 42363140 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-(3-cyanophenyl)-4-[(3R)-1,1-dioxothiolan-3-yl]sulfonylbenzamide |
| SMILES | N#Cc1cccc(NC(=O)c2ccc(S(=O)(=O)[C@@H]3CCS(=O)(=O)C3)cc2)c1 |
| InChI | InChI=1S/C18H16N2O5S2/c19-11-13-2-1-3-15(10-13)20-18(21)14-4-6-16(7-5-14)27(24,25)17-8-9-26(22,23)12-17/h1-7,10,17H,8-9,12H2,(H,20,21)/t17-/m1/s1 |
| InChIKey | JKVRYQRPMUXWOR-QGZVFWFLSA-N |
| XLogP | 1.77 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |