C17H16N4O3S — CID 109237328
N-(3-cyanophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-3-carboxamide (PubChem CID 109237328) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is N-(3-cyanophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-(3-cyanophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109237328 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(3-cyanophenyl)-5-[(1,1-dioxothiolan-3-yl)amino]pyridine-3-carboxamide |
| SMILES | N#Cc1cccc(NC(=O)c2cncc(NC3CCS(=O)(=O)C3)c2)c1 |
| InChI | InChI=1S/C17H16N4O3S/c18-8-12-2-1-3-14(6-12)21-17(22)13-7-16(10-19-9-13)20-15-4-5-25(23,24)11-15/h1-3,6-7,9-10,15,20H,4-5,11H2,(H,21,22) |
| InChIKey | UOOVPJGYCNQYBO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |