C19H23N3O4S — CID 109149252
4-N-(3-cyanophenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclohexane-1,4-dicarboxamide (PubChem CID 109149252) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-N-(3-cyanophenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-cyanophenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149252 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-N-(3-cyanophenyl)-1-N-(1,1-dioxothiolan-3-yl)cyclohexane-1,4-dicarboxamide |
| SMILES | N#Cc1cccc(NC(=O)C2CCC(C(=O)NC3CCS(=O)(=O)C3)CC2)c1 |
| InChI | InChI=1S/C19H23N3O4S/c20-11-13-2-1-3-16(10-13)21-18(23)14-4-6-15(7-5-14)19(24)22-17-8-9-27(25,26)12-17/h1-3,10,14-15,17H,4-9,12H2,(H,21,23)(H,22,24) |
| InChIKey | YTIVMPHPCYOXLF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |