C13H14N2O3S — CID 9269904
N-(3-cyanophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 9269904) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 9269904 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | N#Cc1cccc(NC(=O)C[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H14N2O3S/c14-8-10-2-1-3-12(6-10)15-13(16)7-11-4-5-19(17,18)9-11/h1-3,6,11H,4-5,7,9H2,(H,15,16)/t11-/m1/s1 |
| InChIKey | YNTNULRZJFRYSP-LLVKDONJSA-N |
| XLogP | 1.32 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |