C15H19N3O3S — CID 109003480
N-(3-cyanophenyl)-2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide (PubChem CID 109003480) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 109003480 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(C#N)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19N3O3S/c1-2-18(14-6-7-22(20,21)11-14)10-15(19)17-13-5-3-4-12(8-13)9-16/h3-5,8,14H,2,6-7,10-11H2,1H3,(H,17,19) |
| InChIKey | TYUBKXJCQIOTRO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |