C19H20N4O3S — CID 109215782
4-(3-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-2-carboxamide (PubChem CID 109215782) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 4-(3-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-2-carboxamide.
| Compound Name | 4-(3-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 109215782 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 4-(3-cyanoanilino)-N-(1,1-dioxothiolan-3-yl)-N-ethylpyridine-2-carboxamide |
| SMILES | CCN(C(=O)c1cc(Nc2cccc(C#N)c2)ccn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20N4O3S/c1-2-23(17-7-9-27(25,26)13-17)19(24)18-11-16(6-8-21-18)22-15-5-3-4-14(10-15)12-20/h3-6,8,10-11,17H,2,7,9,13H2,1H3,(H,21,22) |
| InChIKey | CMYPPNJWRPVKLD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |