C15H17N3O3 — CID 60839707
3-[[2-(3-cyanoanilino)-2-oxoethyl]-cyclopropylamino]propanoic acid (PubChem CID 60839707) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 3-[[2-(3-cyanoanilino)-2-oxoethyl]-cyclopropylamino]propanoic acid.
| Compound Name | 3-[[2-(3-cyanoanilino)-2-oxoethyl]-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 60839707 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-[[2-(3-cyanoanilino)-2-oxoethyl]-cyclopropylamino]propanoic acid |
| SMILES | N#Cc1cccc(NC(=O)CN(CCC(=O)O)C2CC2)c1 |
| InChI | InChI=1S/C15H17N3O3/c16-9-11-2-1-3-12(8-11)17-14(19)10-18(13-4-5-13)7-6-15(20)21/h1-3,8,13H,4-7,10H2,(H,17,19)(H,20,21) |
| InChIKey | KIQBZZPRRIYSND-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |