C18H19NO6S2 — CID 42363694
3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(4-methoxyphenyl)benzamide (PubChem CID 42363694) has the molecular formula C18H19NO6S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(4-methoxyphenyl)benzamide.
| Compound Name | 3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 42363694 |
| Molecular Formula | C18H19NO6S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(S(=O)(=O)[C@@H]3CCS(=O)(=O)C3)c2)cc1 |
| InChI | InChI=1S/C18H19NO6S2/c1-25-15-7-5-14(6-8-15)19-18(20)13-3-2-4-16(11-13)27(23,24)17-9-10-26(21,22)12-17/h2-8,11,17H,9-10,12H2,1H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | XYKBDWQAQYKTPT-QGZVFWFLSA-N |
| XLogP | 1.91 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |