C20H23NO6S2 — CID 42363700
3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-propan-2-yloxyphenyl)benzamide (PubChem CID 42363700) has the molecular formula C20H23NO6S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-propan-2-yloxyphenyl)benzamide.
| Compound Name | 3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-propan-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 42363700 |
| Molecular Formula | C20H23NO6S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 3-[(3R)-1,1-dioxothiolan-3-yl]sulfonyl-N-(2-propan-2-yloxyphenyl)benzamide |
| SMILES | CC(C)Oc1ccccc1NC(=O)c1cccc(S(=O)(=O)[C@@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C20H23NO6S2/c1-14(2)27-19-9-4-3-8-18(19)21-20(22)15-6-5-7-16(12-15)29(25,26)17-10-11-28(23,24)13-17/h3-9,12,14,17H,10-11,13H2,1-2H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | HCYRFKIYXFKNMS-QGZVFWFLSA-N |
| XLogP | 2.69 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |