C15H20O5S — CID 64747948
2-methoxy-5-(4-methylcyclohexyl)sulfonylbenzoic acid (PubChem CID 64747948) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-methoxy-5-(4-methylcyclohexyl)sulfonylbenzoic acid.
| Compound Name | 2-methoxy-5-(4-methylcyclohexyl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 64747948 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-methoxy-5-(4-methylcyclohexyl)sulfonylbenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)C2CCC(C)CC2)cc1C(=O)O |
| InChI | InChI=1S/C15H20O5S/c1-10-3-5-11(6-4-10)21(18,19)12-7-8-14(20-2)13(9-12)15(16)17/h7-11H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | VRWLMIZCGOACPF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |