C12H14Cl2N2O4S — CID 43514463
2,5-dichloro-3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid (PubChem CID 43514463) has the molecular formula C12H14Cl2N2O4S and a molecular weight of 353.23 g/mol. Its IUPAC name is 2,5-dichloro-3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid.
| Compound Name | 2,5-dichloro-3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43514463 |
| Molecular Formula | C12H14Cl2N2O4S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2,5-dichloro-3-(4-methylpiperazin-1-yl)sulfonylbenzoic acid |
| SMILES | CN1CCN(S(=O)(=O)c2cc(Cl)cc(C(=O)O)c2Cl)CC1 |
| InChI | InChI=1S/C12H14Cl2N2O4S/c1-15-2-4-16(5-3-15)21(19,20)10-7-8(13)6-9(11(10)14)12(17)18/h6-7H,2-5H2,1H3,(H,17,18) |
| InChIKey | OYILHHCXKLXTBO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |