C12H14ClNO4S2 — CID 82883111
5-chloro-2-methyl-3-thiomorpholin-4-ylsulfonylbenzoic acid (PubChem CID 82883111) has the molecular formula C12H14ClNO4S2 and a molecular weight of 335.83 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-thiomorpholin-4-ylsulfonylbenzoic acid.
| Compound Name | 5-chloro-2-methyl-3-thiomorpholin-4-ylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 82883111 |
| Molecular Formula | C12H14ClNO4S2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 5-chloro-2-methyl-3-thiomorpholin-4-ylsulfonylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C12H14ClNO4S2/c1-8-10(12(15)16)6-9(13)7-11(8)20(17,18)14-2-4-19-5-3-14/h6-7H,2-5H2,1H3,(H,15,16) |
| InChIKey | BVLHWCPVWUAITJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |