C13H14ClNO4S — CID 114408252
5-chloro-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-methylbenzoic acid (PubChem CID 114408252) has the molecular formula C13H14ClNO4S and a molecular weight of 315.78 g/mol. Its IUPAC name is 5-chloro-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-methylbenzoic acid.
| Compound Name | 5-chloro-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 114408252 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 5-chloro-3-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)N1CC=CCC1 |
| InChI | InChI=1S/C13H14ClNO4S/c1-9-11(13(16)17)7-10(14)8-12(9)20(18,19)15-5-3-2-4-6-15/h2-3,7-8H,4-6H2,1H3,(H,16,17) |
| InChIKey | MTQXUKOGWXOJKT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|