C13H14ClNO5S — CID 166279422
5-chloro-3-[[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]sulfonyl]-2-methylbenzoic acid (PubChem CID 166279422) has the molecular formula C13H14ClNO5S and a molecular weight of 331.78 g/mol. Its IUPAC name is 5-chloro-3-[[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]sulfonyl]-2-methylbenzoic acid.
| Compound Name | 5-chloro-3-[[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]sulfonyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 166279422 |
| Molecular Formula | C13H14ClNO5S |
| Molecular Weight | 331.78 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5-chloro-3-[[2-(hydroxymethyl)-2,5-dihydropyrrol-1-yl]sulfonyl]-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)N1CC=CC1CO |
| InChI | InChI=1S/C13H14ClNO5S/c1-8-11(13(17)18)5-9(14)6-12(8)21(19,20)15-4-2-3-10(15)7-16/h2-3,5-6,10,16H,4,7H2,1H3,(H,17,18) |
| InChIKey | XFHNEWUWRLCGNJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.78 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|