C14H17ClO5S — CID 103135520
5-chloro-2-methyl-3-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid (PubChem CID 103135520) has the molecular formula C14H17ClO5S and a molecular weight of 332.81 g/mol. Its IUPAC name is 5-chloro-2-methyl-3-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid.
| Compound Name | 5-chloro-2-methyl-3-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 103135520 |
| Molecular Formula | C14H17ClO5S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 5-chloro-2-methyl-3-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Cl)cc1S(=O)(=O)CC1CCC(C)O1 |
| InChI | InChI=1S/C14H17ClO5S/c1-8-3-4-11(20-8)7-21(18,19)13-6-10(15)5-12(9(13)2)14(16)17/h5-6,8,11H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | FURREBUFGSHEFY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |