C12H16ClNO3S — CID 103143113
5-chloro-2-[(5-methyloxolan-2-yl)methylsulfonyl]aniline (PubChem CID 103143113) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 5-chloro-2-[(5-methyloxolan-2-yl)methylsulfonyl]aniline.
| Compound Name | 5-chloro-2-[(5-methyloxolan-2-yl)methylsulfonyl]aniline |
|---|---|
| PubChem CID | 103143113 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 5-chloro-2-[(5-methyloxolan-2-yl)methylsulfonyl]aniline |
| SMILES | CC1CCC(CS(=O)(=O)c2ccc(Cl)cc2N)O1 |
| InChI | InChI=1S/C12H16ClNO3S/c1-8-2-4-10(17-8)7-18(15,16)12-5-3-9(13)6-11(12)14/h3,5-6,8,10H,2,4,7,14H2,1H3 |
| InChIKey | XTTIEIQHQCPCCN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|