C13H15FO5S — CID 103134416
2-fluoro-5-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid (PubChem CID 103134416) has the molecular formula C13H15FO5S and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-fluoro-5-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid.
| Compound Name | 2-fluoro-5-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 103134416 |
| Molecular Formula | C13H15FO5S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-fluoro-5-[(5-methyloxolan-2-yl)methylsulfonyl]benzoic acid |
| SMILES | CC1CCC(CS(=O)(=O)c2ccc(F)c(C(=O)O)c2)O1 |
| InChI | InChI=1S/C13H15FO5S/c1-8-2-3-9(19-8)7-20(17,18)10-4-5-12(14)11(6-10)13(15)16/h4-6,8-9H,2-3,7H2,1H3,(H,15,16) |
| InChIKey | JFXBEEWKDOOFAL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |