C13H13F4NO4S — CID 20506103
2-fluoro-5-[4-(trifluoromethyl)piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 20506103) has the molecular formula C13H13F4NO4S and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-fluoro-5-[4-(trifluoromethyl)piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-fluoro-5-[4-(trifluoromethyl)piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 20506103 |
| Molecular Formula | C13H13F4NO4S |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2-fluoro-5-[4-(trifluoromethyl)piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCC(C(F)(F)F)CC2)ccc1F |
| InChI | InChI=1S/C13H13F4NO4S/c14-11-2-1-9(7-10(11)12(19)20)23(21,22)18-5-3-8(4-6-18)13(15,16)17/h1-2,7-8H,3-6H2,(H,19,20) |
| InChIKey | OXDUXMCGDCVIBI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |