C15H21FN2O4S — CID 124683086
5-[(3R)-3-(diethylamino)pyrrolidin-1-yl]sulfonyl-2-fluorobenzoic acid (PubChem CID 124683086) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is 5-[(3R)-3-(diethylamino)pyrrolidin-1-yl]sulfonyl-2-fluorobenzoic acid.
| Compound Name | 5-[(3R)-3-(diethylamino)pyrrolidin-1-yl]sulfonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 124683086 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 5-[(3R)-3-(diethylamino)pyrrolidin-1-yl]sulfonyl-2-fluorobenzoic acid |
| SMILES | CCN(CC)[C@@H]1CCN(S(=O)(=O)c2ccc(F)c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C15H21FN2O4S/c1-3-17(4-2)11-7-8-18(10-11)23(21,22)12-5-6-14(16)13(9-12)15(19)20/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | IJYRGSDYHAYMEP-LLVKDONJSA-N |
| XLogP | 1.63 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |