C13H21N3O4S — CID 63168236
4-[3-(diethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrrole-2-carboxylic acid (PubChem CID 63168236) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-[3-(diethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[3-(diethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 63168236 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-[3-(diethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrrole-2-carboxylic acid |
| SMILES | CCN(CC)C1CCN(S(=O)(=O)c2c[nH]c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C13H21N3O4S/c1-3-15(4-2)10-5-6-16(9-10)21(19,20)11-7-12(13(17)18)14-8-11/h7-8,10,14H,3-6,9H2,1-2H3,(H,17,18) |
| InChIKey | OMNJWODEBKLVLE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |