C10H14N2O5S — CID 28740525
4-(4-hydroxypiperidin-1-yl)sulfonyl-1H-pyrrole-2-carboxylic acid (PubChem CID 28740525) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 4-(4-hydroxypiperidin-1-yl)sulfonyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(4-hydroxypiperidin-1-yl)sulfonyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 28740525 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-(4-hydroxypiperidin-1-yl)sulfonyl-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCC(O)CC2)c[nH]1 |
| InChI | InChI=1S/C10H14N2O5S/c13-7-1-3-12(4-2-7)18(16,17)8-5-9(10(14)15)11-6-8/h5-7,11,13H,1-4H2,(H,14,15) |
| InChIKey | ILUNUHRRCVVVHN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |