C9H12N2O4S — CID 107877559
5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonyl-1H-pyridin-2-one (PubChem CID 107877559) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is 5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonyl-1H-pyridin-2-one.
| Compound Name | 5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 107877559 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-[(3S)-3-hydroxypyrrolidin-1-yl]sulfonyl-1H-pyridin-2-one |
| SMILES | O=c1ccc(S(=O)(=O)N2CC[C@H](O)C2)c[nH]1 |
| InChI | InChI=1S/C9H12N2O4S/c12-7-3-4-11(6-7)16(14,15)8-1-2-9(13)10-5-8/h1-2,5,7,12H,3-4,6H2,(H,10,13)/t7-/m0/s1 |
| InChIKey | NQKHOVOVVCASDV-ZETCQYMHSA-N |
| XLogP | -0.87 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |