C10H13N3O5S — CID 65366054
4-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 65366054) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is 4-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 65366054 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C1CN(S(=O)(=O)c2c[nH]c(C(=O)O)c2)CCCN1 |
| InChI | InChI=1S/C10H13N3O5S/c14-9-6-13(3-1-2-11-9)19(17,18)7-4-8(10(15)16)12-5-7/h4-5,12H,1-3,6H2,(H,11,14)(H,15,16) |
| InChIKey | ZATIAMQVCYYEAV-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |