C9H11ClN4O3S — CID 65366121
4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-diazepan-2-one (PubChem CID 65366121) has the molecular formula C9H11ClN4O3S and a molecular weight of 290.73 g/mol. Its IUPAC name is 4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-diazepan-2-one.
| Compound Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65366121 |
| Molecular Formula | C9H11ClN4O3S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-1,4-diazepan-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cnc(Cl)nc2)CCCN1 |
| InChI | InChI=1S/C9H11ClN4O3S/c10-9-12-4-7(5-13-9)18(16,17)14-3-1-2-11-8(15)6-14/h4-5H,1-3,6H2,(H,11,15) |
| InChIKey | STVQRJCSGCBVSN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |