C7H10N4O3S — CID 47265881
4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one (PubChem CID 47265881) has the molecular formula C7H10N4O3S and a molecular weight of 230.25 g/mol. Its IUPAC name is 4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one.
| Compound Name | 4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one |
|---|---|
| PubChem CID | 47265881 |
| Molecular Formula | C7H10N4O3S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cn[nH]c2)CCN1 |
| InChI | InChI=1S/C7H10N4O3S/c12-7-5-11(2-1-8-7)15(13,14)6-3-9-10-4-6/h3-4H,1-2,5H2,(H,8,12)(H,9,10) |
| InChIKey | OKOAGJPCKNJZBF-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |