C8H12N4O3S — CID 63607963
3-methyl-4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one (PubChem CID 63607963) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 3-methyl-4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one.
| Compound Name | 3-methyl-4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one |
|---|---|
| PubChem CID | 63607963 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 3-methyl-4-(1H-pyrazol-4-ylsulfonyl)piperazin-2-one |
| SMILES | CC1C(=O)NCCN1S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C8H12N4O3S/c1-6-8(13)9-2-3-12(6)16(14,15)7-4-10-11-5-7/h4-6H,2-3H2,1H3,(H,9,13)(H,10,11) |
| InChIKey | VGFVXJDRTHEHDC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |