C9H15N3O2S — CID 60928789
2-methyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine (PubChem CID 60928789) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-methyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine.
| Compound Name | 2-methyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine |
|---|---|
| PubChem CID | 60928789 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-methyl-1-(1H-pyrazol-4-ylsulfonyl)piperidine |
| SMILES | CC1CCCCN1S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C9H15N3O2S/c1-8-4-2-3-5-12(8)15(13,14)9-6-10-11-7-9/h6-8H,2-5H2,1H3,(H,10,11) |
| InChIKey | QVDKWIDWEUMHML-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |