C10H18N4O2S — CID 116640142
[1-(1H-pyrazol-4-ylsulfonyl)azepan-2-yl]methanamine (PubChem CID 116640142) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is [1-(1H-pyrazol-4-ylsulfonyl)azepan-2-yl]methanamine.
| Compound Name | [1-(1H-pyrazol-4-ylsulfonyl)azepan-2-yl]methanamine |
|---|---|
| PubChem CID | 116640142 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [1-(1H-pyrazol-4-ylsulfonyl)azepan-2-yl]methanamine |
| SMILES | NCC1CCCCCN1S(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H18N4O2S/c11-6-9-4-2-1-3-5-14(9)17(15,16)10-7-12-13-8-10/h7-9H,1-6,11H2,(H,12,13) |
| InChIKey | CVLFITJVYWTFMZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |