C11H15N3O5S2 — CID 63361950
3-(2-methyl-3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide (PubChem CID 63361950) has the molecular formula C11H15N3O5S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-(2-methyl-3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide.
| Compound Name | 3-(2-methyl-3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 63361950 |
| Molecular Formula | C11H15N3O5S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-(2-methyl-3-oxopiperazin-1-yl)sulfonylbenzenesulfonamide |
| SMILES | CC1C(=O)NCCN1S(=O)(=O)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H15N3O5S2/c1-8-11(15)13-5-6-14(8)21(18,19)10-4-2-3-9(7-10)20(12,16)17/h2-4,7-8H,5-6H2,1H3,(H,13,15)(H2,12,16,17) |
| InChIKey | AAHFZBGORGURNY-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |