C7H11N5O3S — CID 60814377
4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazin-2-one (PubChem CID 60814377) has the molecular formula C7H11N5O3S and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazin-2-one.
| Compound Name | 4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazin-2-one |
|---|---|
| PubChem CID | 60814377 |
| Molecular Formula | C7H11N5O3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-[(5-amino-1H-pyrazol-4-yl)sulfonyl]piperazin-2-one |
| SMILES | Nc1[nH]ncc1S(=O)(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C7H11N5O3S/c8-7-5(3-10-11-7)16(14,15)12-2-1-9-6(13)4-12/h3H,1-2,4H2,(H,9,13)(H3,8,10,11) |
| InChIKey | JRJRUDGIFOAKMW-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |