C10H11BrClN3O3S — CID 55152526
4-(3-amino-2-bromo-5-chlorophenyl)sulfonylpiperazin-2-one (PubChem CID 55152526) has the molecular formula C10H11BrClN3O3S and a molecular weight of 368.64 g/mol. Its IUPAC name is 4-(3-amino-2-bromo-5-chlorophenyl)sulfonylpiperazin-2-one.
| Compound Name | 4-(3-amino-2-bromo-5-chlorophenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 55152526 |
| Molecular Formula | C10H11BrClN3O3S |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | 4-(3-amino-2-bromo-5-chlorophenyl)sulfonylpiperazin-2-one |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)N2CCNC(=O)C2)c1Br |
| InChI | InChI=1S/C10H11BrClN3O3S/c11-10-7(13)3-6(12)4-8(10)19(17,18)15-2-1-14-9(16)5-15/h3-4H,1-2,5,13H2,(H,14,16) |
| InChIKey | ROZGOLTUCWCKJQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|