C12H17BrClN3O2S — CID 62957756
2-bromo-5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline (PubChem CID 62957756) has the molecular formula C12H17BrClN3O2S and a molecular weight of 382.71 g/mol. Its IUPAC name is 2-bromo-5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline.
| Compound Name | 2-bromo-5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 62957756 |
| Molecular Formula | C12H17BrClN3O2S |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 2-bromo-5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline |
| SMILES | CN1CCCN(S(=O)(=O)c2cc(Cl)cc(N)c2Br)CC1 |
| InChI | InChI=1S/C12H17BrClN3O2S/c1-16-3-2-4-17(6-5-16)20(18,19)11-8-9(14)7-10(15)12(11)13/h7-8H,2-6,15H2,1H3 |
| InChIKey | FHWMUQUPROBRFP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|