C11H17ClN4O2S — CID 75441729
5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]pyridin-2-amine (PubChem CID 75441729) has the molecular formula C11H17ClN4O2S and a molecular weight of 304.80 g/mol. Its IUPAC name is 5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 75441729 |
| Molecular Formula | C11H17ClN4O2S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 5-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]pyridin-2-amine |
| SMILES | CN1CCCN(S(=O)(=O)c2cc(Cl)cnc2N)CC1 |
| InChI | InChI=1S/C11H17ClN4O2S/c1-15-3-2-4-16(6-5-15)19(17,18)10-7-9(12)8-14-11(10)13/h7-8H,2-6H2,1H3,(H2,13,14) |
| InChIKey | OZHVCHIIICVRQR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |