C12H18ClN3O2S — CID 28542859
4-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline (PubChem CID 28542859) has the molecular formula C12H18ClN3O2S and a molecular weight of 303.81 g/mol. Its IUPAC name is 4-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline.
| Compound Name | 4-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline |
|---|---|
| PubChem CID | 28542859 |
| Molecular Formula | C12H18ClN3O2S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-chloro-3-[(4-methyl-1,4-diazepan-1-yl)sulfonyl]aniline |
| SMILES | CN1CCCN(S(=O)(=O)c2cc(N)ccc2Cl)CC1 |
| InChI | InChI=1S/C12H18ClN3O2S/c1-15-5-2-6-16(8-7-15)19(17,18)12-9-10(14)3-4-11(12)13/h3-4,9H,2,5-8,14H2,1H3 |
| InChIKey | GRFWHKKMEZEHAG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|