C11H16N4O3S — CID 65363865
4-[[6-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-2-one (PubChem CID 65363865) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 4-[[6-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-2-one.
| Compound Name | 4-[[6-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 65363865 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 4-[[6-(methylamino)-3-pyridinyl]sulfonyl]-1,4-diazepan-2-one |
| SMILES | CNc1ccc(S(=O)(=O)N2CCCNC(=O)C2)cn1 |
| InChI | InChI=1S/C11H16N4O3S/c1-12-10-4-3-9(7-14-10)19(17,18)15-6-2-5-13-11(16)8-15/h3-4,7H,2,5-6,8H2,1H3,(H,12,14)(H,13,16) |
| InChIKey | GZGFRDGVERQXFA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |