C9H11N5O4S — CID 66063379
4-[(6-hydrazinyl-3-pyridinyl)sulfonyl]piperazine-2,6-dione (PubChem CID 66063379) has the molecular formula C9H11N5O4S and a molecular weight of 285.28 g/mol. Its IUPAC name is 4-[(6-hydrazinyl-3-pyridinyl)sulfonyl]piperazine-2,6-dione.
| Compound Name | 4-[(6-hydrazinyl-3-pyridinyl)sulfonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66063379 |
| Molecular Formula | C9H11N5O4S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 4-[(6-hydrazinyl-3-pyridinyl)sulfonyl]piperazine-2,6-dione |
| SMILES | NNc1ccc(S(=O)(=O)N2CC(=O)NC(=O)C2)cn1 |
| InChI | InChI=1S/C9H11N5O4S/c10-13-7-2-1-6(3-11-7)19(17,18)14-4-8(15)12-9(16)5-14/h1-3H,4-5,10H2,(H,11,13)(H,12,15,16) |
| InChIKey | OXIWHCCRMNZFFY-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|