C13H14N4O2S — CID 62231833
[5-(1,3-dihydroisoindol-2-ylsulfonyl)-2-pyridinyl]hydrazine (PubChem CID 62231833) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is [5-(1,3-dihydroisoindol-2-ylsulfonyl)-2-pyridinyl]hydrazine.
| Compound Name | [5-(1,3-dihydroisoindol-2-ylsulfonyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 62231833 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | [5-(1,3-dihydroisoindol-2-ylsulfonyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(S(=O)(=O)N2Cc3ccccc3C2)cn1 |
| InChI | InChI=1S/C13H14N4O2S/c14-16-13-6-5-12(7-15-13)20(18,19)17-8-10-3-1-2-4-11(10)9-17/h1-7H,8-9,14H2,(H,15,16) |
| InChIKey | VHBLPTDDZDXWFZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|