C13H14N4O2S — CID 62231057
5-(1,3-dihydroisoindol-2-ylsulfonyl)-N-methylpyrimidin-2-amine (PubChem CID 62231057) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 5-(1,3-dihydroisoindol-2-ylsulfonyl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-(1,3-dihydroisoindol-2-ylsulfonyl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 62231057 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 5-(1,3-dihydroisoindol-2-ylsulfonyl)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(S(=O)(=O)N2Cc3ccccc3C2)cn1 |
| InChI | InChI=1S/C13H14N4O2S/c1-14-13-15-6-12(7-16-13)20(18,19)17-8-10-4-2-3-5-11(10)9-17/h2-7H,8-9H2,1H3,(H,14,15,16) |
| InChIKey | ZFIPPKFSJCSQLK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |