C9H9N3O5S — CID 66063399
4-[(6-oxo-1H-pyridin-3-yl)sulfonyl]piperazine-2,6-dione (PubChem CID 66063399) has the molecular formula C9H9N3O5S and a molecular weight of 271.25 g/mol. Its IUPAC name is 4-[(6-oxo-1H-pyridin-3-yl)sulfonyl]piperazine-2,6-dione.
| Compound Name | 4-[(6-oxo-1H-pyridin-3-yl)sulfonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66063399 |
| Molecular Formula | C9H9N3O5S |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 4-[(6-oxo-1H-pyridin-3-yl)sulfonyl]piperazine-2,6-dione |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(=O)[nH]c2)CC(=O)N1 |
| InChI | InChI=1S/C9H9N3O5S/c13-7-2-1-6(3-10-7)18(16,17)12-4-8(14)11-9(15)5-12/h1-3H,4-5H2,(H,10,13)(H,11,14,15) |
| InChIKey | SEYGVUXDJPUCQR-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|