C10H10FN3O4S — CID 82843665
4-(4-amino-3-fluorophenyl)sulfonylpiperazine-2,6-dione (PubChem CID 82843665) has the molecular formula C10H10FN3O4S and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-(4-amino-3-fluorophenyl)sulfonylpiperazine-2,6-dione.
| Compound Name | 4-(4-amino-3-fluorophenyl)sulfonylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 82843665 |
| Molecular Formula | C10H10FN3O4S |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 4-(4-amino-3-fluorophenyl)sulfonylpiperazine-2,6-dione |
| SMILES | Nc1ccc(S(=O)(=O)N2CC(=O)NC(=O)C2)cc1F |
| InChI | InChI=1S/C10H10FN3O4S/c11-7-3-6(1-2-8(7)12)19(17,18)14-4-9(15)13-10(16)5-14/h1-3H,4-5,12H2,(H,13,15,16) |
| InChIKey | JGELKUKRYLLJMT-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|