C11H10N2O7S — CID 66085075
5-(3,5-dioxopiperazin-1-yl)sulfonyl-2-hydroxybenzoic acid (PubChem CID 66085075) has the molecular formula C11H10N2O7S and a molecular weight of 314.28 g/mol. Its IUPAC name is 5-(3,5-dioxopiperazin-1-yl)sulfonyl-2-hydroxybenzoic acid.
| Compound Name | 5-(3,5-dioxopiperazin-1-yl)sulfonyl-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 66085075 |
| Molecular Formula | C11H10N2O7S |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 5-(3,5-dioxopiperazin-1-yl)sulfonyl-2-hydroxybenzoic acid |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(O)c(C(=O)O)c2)CC(=O)N1 |
| InChI | InChI=1S/C11H10N2O7S/c14-8-2-1-6(3-7(8)11(17)18)21(19,20)13-4-9(15)12-10(16)5-13/h1-3,14H,4-5H2,(H,17,18)(H,12,15,16) |
| InChIKey | VHYNWADFTCABCC-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|