C10H15N5O3S — CID 63661604
6-hydrazinyl-N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide (PubChem CID 63661604) has the molecular formula C10H15N5O3S and a molecular weight of 285.33 g/mol. Its IUPAC name is 6-hydrazinyl-N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63661604 |
| Molecular Formula | C10H15N5O3S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 6-hydrazinyl-N-(6-oxopiperidin-3-yl)pyridine-3-sulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)NC2CCC(=O)NC2)cn1 |
| InChI | InChI=1S/C10H15N5O3S/c11-14-9-3-2-8(6-12-9)19(17,18)15-7-1-4-10(16)13-5-7/h2-3,6-7,15H,1,4-5,11H2,(H,12,14)(H,13,16) |
| InChIKey | BEEUVGQDPGPPLB-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|