About 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one
4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one (PubChem CID 65361241) has the molecular formula C13H19N3O3S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one |
| PubChem CID | 65361241 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one |
| SMILES | Cc1cc(N)c(S(=O)(=O)N2CCCNC(=O)C2)cc1C |
| InChI | InChI=1S/C13H19N3O3S/c1-9-6-11(14)12(7-10(9)2)20(18,19)16-5-3-4-15-13(17)8-16/h6-7H,3-5,8,14H2,1-2H3,(H,15,17) |
| InChIKey | POIRGBHWVWZVOW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one?
The IUPAC name of 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one (CID 65361241) is 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one.
What is the SMILES notation for 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one?
The canonical SMILES for 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one is Cc1cc(N)c(S(=O)(=O)N2CCCNC(=O)C2)cc1C.
What is the InChIKey of 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one?
The InChIKey is POIRGBHWVWZVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3S/c1-9-6-11(14)12(7-10(9)2)20(18,19)16-5-3-4-15-13(17)8-16/h6-7H,3-5,8,14H2,1-2H3,(H,15,17).
What are the key properties of 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one?
4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one has a molecular weight of 297.38 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4,5-dimethylphenyl)sulfonyl-1,4-diazepan-2-one is sourced from PubChem (CID 65361241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).