C13H16N4O3S — CID 66000546
4-[(6-amino-1H-indol-3-yl)sulfonyl]-1,4-diazepan-2-one (PubChem CID 66000546) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-[(6-amino-1H-indol-3-yl)sulfonyl]-1,4-diazepan-2-one.
| Compound Name | 4-[(6-amino-1H-indol-3-yl)sulfonyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 66000546 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-[(6-amino-1H-indol-3-yl)sulfonyl]-1,4-diazepan-2-one |
| SMILES | Nc1ccc2c(S(=O)(=O)N3CCCNC(=O)C3)c[nH]c2c1 |
| InChI | InChI=1S/C13H16N4O3S/c14-9-2-3-10-11(6-9)16-7-12(10)21(19,20)17-5-1-4-15-13(18)8-17/h2-3,6-7,16H,1,4-5,8,14H2,(H,15,18) |
| InChIKey | USJCFWBAALXUGA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|