C12H14N4O3S — CID 65360997
5-amino-2-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile (PubChem CID 65360997) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 5-amino-2-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile.
| Compound Name | 5-amino-2-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 65360997 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-amino-2-[(3-oxo-1,4-diazepan-1-yl)sulfonyl]benzonitrile |
| SMILES | N#Cc1cc(N)ccc1S(=O)(=O)N1CCCNC(=O)C1 |
| InChI | InChI=1S/C12H14N4O3S/c13-7-9-6-10(14)2-3-11(9)20(18,19)16-5-1-4-15-12(17)8-16/h2-3,6H,1,4-5,8,14H2,(H,15,17) |
| InChIKey | VHERGMAEBOYCMV-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|