C11H15N3O4S — CID 43257198
4-(4-amino-2-methoxyphenyl)sulfonylpiperazin-2-one (PubChem CID 43257198) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 4-(4-amino-2-methoxyphenyl)sulfonylpiperazin-2-one.
| Compound Name | 4-(4-amino-2-methoxyphenyl)sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 43257198 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-(4-amino-2-methoxyphenyl)sulfonylpiperazin-2-one |
| SMILES | COc1cc(N)ccc1S(=O)(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C11H15N3O4S/c1-18-9-6-8(12)2-3-10(9)19(16,17)14-5-4-13-11(15)7-14/h2-3,6H,4-5,7,12H2,1H3,(H,13,15) |
| InChIKey | XYSCRSVNKIMYBV-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|