C13H19N3O4S — CID 63596125
4-(4-amino-2-methoxyphenyl)sulfonyl-3,3-dimethylpiperazin-2-one (PubChem CID 63596125) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-(4-amino-2-methoxyphenyl)sulfonyl-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(4-amino-2-methoxyphenyl)sulfonyl-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63596125 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 4-(4-amino-2-methoxyphenyl)sulfonyl-3,3-dimethylpiperazin-2-one |
| SMILES | COc1cc(N)ccc1S(=O)(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C13H19N3O4S/c1-13(2)12(17)15-6-7-16(13)21(18,19)11-5-4-9(14)8-10(11)20-3/h4-5,8H,6-7,14H2,1-3H3,(H,15,17) |
| InChIKey | IROJAYAKSRSVFR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|