C13H17ClN2O3S — CID 63606748
4-(5-chloro-2-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one (PubChem CID 63606748) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(5-chloro-2-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63606748 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)sulfonyl-3,3-dimethylpiperazin-2-one |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C13H17ClN2O3S/c1-9-4-5-10(14)8-11(9)20(18,19)16-7-6-15-12(17)13(16,2)3/h4-5,8H,6-7H2,1-3H3,(H,15,17) |
| InChIKey | VTSZFKKWEZFDBL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |